C13H18FN3O2S — CID 62377585
1-(1-ethyl-6-fluorobenzimidazol-2-yl)-3-methylsulfonylpropan-1-amine (PubChem CID 62377585) has the molecular formula C13H18FN3O2S and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-(1-ethyl-6-fluorobenzimidazol-2-yl)-3-methylsulfonylpropan-1-amine.
| Compound Name | 1-(1-ethyl-6-fluorobenzimidazol-2-yl)-3-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 62377585 |
| Molecular Formula | C13H18FN3O2S |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 1-(1-ethyl-6-fluorobenzimidazol-2-yl)-3-methylsulfonylpropan-1-amine |
| SMILES | CCn1c(C(N)CCS(C)(=O)=O)nc2ccc(F)cc21 |
| InChI | InChI=1S/C13H18FN3O2S/c1-3-17-12-8-9(14)4-5-11(12)16-13(17)10(15)6-7-20(2,18)19/h4-5,8,10H,3,6-7,15H2,1-2H3 |
| InChIKey | FBXIRELUCWQYEW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |