C13H21NO3 — CID 54920642
methyl 4-[1-(2,5-dimethylfuran-3-yl)ethylamino]butanoate (PubChem CID 54920642) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is methyl 4-[1-(2,5-dimethylfuran-3-yl)ethylamino]butanoate.
| Compound Name | methyl 4-[1-(2,5-dimethylfuran-3-yl)ethylamino]butanoate |
|---|---|
| PubChem CID | 54920642 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | methyl 4-[1-(2,5-dimethylfuran-3-yl)ethylamino]butanoate |
| SMILES | COC(=O)CCCNC(C)c1cc(C)oc1C |
| InChI | InChI=1S/C13H21NO3/c1-9-8-12(11(3)17-9)10(2)14-7-5-6-13(15)16-4/h8,10,14H,5-7H2,1-4H3 |
| InChIKey | SLWKFEYLMFFTOS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|