C16H19NO2 — CID 54921713
N-(1-cyclopropylethyl)-2-(4-hydroxybut-1-ynyl)benzamide (PubChem CID 54921713) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is N-(1-cyclopropylethyl)-2-(4-hydroxybut-1-ynyl)benzamide.
| Compound Name | N-(1-cyclopropylethyl)-2-(4-hydroxybut-1-ynyl)benzamide |
|---|---|
| PubChem CID | 54921713 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-(1-cyclopropylethyl)-2-(4-hydroxybut-1-ynyl)benzamide |
| SMILES | CC(NC(=O)c1ccccc1C#CCCO)C1CC1 |
| InChI | InChI=1S/C16H19NO2/c1-12(13-9-10-13)17-16(19)15-8-3-2-6-14(15)7-4-5-11-18/h2-3,6,8,12-13,18H,5,9-11H2,1H3,(H,17,19) |
| InChIKey | BHBYSJXFJQNPFE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|