C13H12F3NO2 — CID 60815894
2-(4-hydroxybut-1-ynyl)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 60815894) has the molecular formula C13H12F3NO2 and a molecular weight of 271.24 g/mol. Its IUPAC name is 2-(4-hydroxybut-1-ynyl)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-(4-hydroxybut-1-ynyl)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 60815894 |
| Molecular Formula | C13H12F3NO2 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 2-(4-hydroxybut-1-ynyl)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1ccccc1C#CCCO |
| InChI | InChI=1S/C13H12F3NO2/c14-13(15,16)9-17-12(19)11-7-2-1-5-10(11)6-3-4-8-18/h1-2,5,7,18H,4,8-9H2,(H,17,19) |
| InChIKey | YEYDTMQNJDKUQP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|