C15H30N2O — CID 54923588
N,2-diethyl-N-piperidin-4-ylhexanamide (PubChem CID 54923588) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is N,2-diethyl-N-piperidin-4-ylhexanamide.
| Compound Name | N,2-diethyl-N-piperidin-4-ylhexanamide |
|---|---|
| PubChem CID | 54923588 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | N,2-diethyl-N-piperidin-4-ylhexanamide |
| SMILES | CCCCC(CC)C(=O)N(CC)C1CCNCC1 |
| InChI | InChI=1S/C15H30N2O/c1-4-7-8-13(5-2)15(18)17(6-3)14-9-11-16-12-10-14/h13-14,16H,4-12H2,1-3H3 |
| InChIKey | JCRYJYKTCGWRAJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |