C11H22N4O2S — CID 54948154
2-[[2-[(3-amino-3-sulfanylidenepropyl)-methylamino]-2-oxoethyl]-ethylamino]-N-methylacetamide (PubChem CID 54948154) has the molecular formula C11H22N4O2S and a molecular weight of 274.39 g/mol. Its IUPAC name is 2-[[2-[(3-amino-3-sulfanylidenepropyl)-methylamino]-2-oxoethyl]-ethylamino]-N-methylacetamide.
| Compound Name | 2-[[2-[(3-amino-3-sulfanylidenepropyl)-methylamino]-2-oxoethyl]-ethylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 54948154 |
| Molecular Formula | C11H22N4O2S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 2-[[2-[(3-amino-3-sulfanylidenepropyl)-methylamino]-2-oxoethyl]-ethylamino]-N-methylacetamide |
| SMILES | CCN(CC(=O)NC)CC(=O)N(C)CCC(N)=S |
| InChI | InChI=1S/C11H22N4O2S/c1-4-15(7-10(16)13-2)8-11(17)14(3)6-5-9(12)18/h4-8H2,1-3H3,(H2,12,18)(H,13,16) |
| InChIKey | TZWGJLJIOAEVMP-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|