C11H13Cl2N3O — CID 54950034
5,6-dichloro-N-(1-methylpyrrolidin-3-yl)pyridine-3-carboxamide (PubChem CID 54950034) has the molecular formula C11H13Cl2N3O and a molecular weight of 274.15 g/mol. Its IUPAC name is 5,6-dichloro-N-(1-methylpyrrolidin-3-yl)pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-(1-methylpyrrolidin-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 54950034 |
| Molecular Formula | C11H13Cl2N3O |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 5,6-dichloro-N-(1-methylpyrrolidin-3-yl)pyridine-3-carboxamide |
| SMILES | CN1CCC(NC(=O)c2cnc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C11H13Cl2N3O/c1-16-3-2-8(6-16)15-11(17)7-4-9(12)10(13)14-5-7/h4-5,8H,2-3,6H2,1H3,(H,15,17) |
| InChIKey | UFEVUEMPVHARJX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|