C14H17Cl2N3O — CID 78968147
N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-5,6-dichloropyridine-3-carboxamide (PubChem CID 78968147) has the molecular formula C14H17Cl2N3O and a molecular weight of 314.22 g/mol. Its IUPAC name is N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-5,6-dichloropyridine-3-carboxamide.
| Compound Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-5,6-dichloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 78968147 |
| Molecular Formula | C14H17Cl2N3O |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-5,6-dichloropyridine-3-carboxamide |
| SMILES | O=C(NC1CCN2CCCC2C1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2N3O/c15-12-6-9(8-17-13(12)16)14(20)18-10-3-5-19-4-1-2-11(19)7-10/h6,8,10-11H,1-5,7H2,(H,18,20) |
| InChIKey | NKAHLUYEHPMRJX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|