C17H24ClN3O2 — CID 47059655
5-chloro-N-(1-cyclopropylpiperidin-4-yl)-6-propan-2-yloxypyridine-3-carboxamide (PubChem CID 47059655) has the molecular formula C17H24ClN3O2 and a molecular weight of 337.85 g/mol. Its IUPAC name is 5-chloro-N-(1-cyclopropylpiperidin-4-yl)-6-propan-2-yloxypyridine-3-carboxamide.
| Compound Name | 5-chloro-N-(1-cyclopropylpiperidin-4-yl)-6-propan-2-yloxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 47059655 |
| Molecular Formula | C17H24ClN3O2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 5-chloro-N-(1-cyclopropylpiperidin-4-yl)-6-propan-2-yloxypyridine-3-carboxamide |
| SMILES | CC(C)Oc1ncc(C(=O)NC2CCN(C3CC3)CC2)cc1Cl |
| InChI | InChI=1S/C17H24ClN3O2/c1-11(2)23-17-15(18)9-12(10-19-17)16(22)20-13-5-7-21(8-6-13)14-3-4-14/h9-11,13-14H,3-8H2,1-2H3,(H,20,22) |
| InChIKey | VYDPNBWPQBNELE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |