C11H13N3O2S — CID 54953799
N-(cyanomethyl)-N'-[1-(5-methylthiophen-2-yl)ethyl]oxamide (PubChem CID 54953799) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-[1-(5-methylthiophen-2-yl)ethyl]oxamide.
| Compound Name | N-(cyanomethyl)-N'-[1-(5-methylthiophen-2-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 54953799 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | N-(cyanomethyl)-N'-[1-(5-methylthiophen-2-yl)ethyl]oxamide |
| SMILES | Cc1ccc(C(C)NC(=O)C(=O)NCC#N)s1 |
| InChI | InChI=1S/C11H13N3O2S/c1-7-3-4-9(17-7)8(2)14-11(16)10(15)13-6-5-12/h3-4,8H,6H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | XCIMSBCHSHBNFP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|