C13H26N2O3 — CID 54957365
2-[butan-2-yl-[2-oxo-2-(pentan-3-ylamino)ethyl]amino]acetic acid (PubChem CID 54957365) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-[butan-2-yl-[2-oxo-2-(pentan-3-ylamino)ethyl]amino]acetic acid.
| Compound Name | 2-[butan-2-yl-[2-oxo-2-(pentan-3-ylamino)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 54957365 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 2-[butan-2-yl-[2-oxo-2-(pentan-3-ylamino)ethyl]amino]acetic acid |
| SMILES | CCC(CC)NC(=O)CN(CC(=O)O)C(C)CC |
| InChI | InChI=1S/C13H26N2O3/c1-5-10(4)15(9-13(17)18)8-12(16)14-11(6-2)7-3/h10-11H,5-9H2,1-4H3,(H,14,16)(H,17,18) |
| InChIKey | DEZKATBIAOLXJD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |