C11H21NO2 — CID 66045977
2-[butan-2-yl(2-methylidenebutyl)amino]acetic acid (PubChem CID 66045977) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 2-[butan-2-yl(2-methylidenebutyl)amino]acetic acid.
| Compound Name | 2-[butan-2-yl(2-methylidenebutyl)amino]acetic acid |
|---|---|
| PubChem CID | 66045977 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 2-[butan-2-yl(2-methylidenebutyl)amino]acetic acid |
| SMILES | C=C(CC)CN(CC(=O)O)C(C)CC |
| InChI | InChI=1S/C11H21NO2/c1-5-9(3)7-12(8-11(13)14)10(4)6-2/h10H,3,5-8H2,1-2,4H3,(H,13,14) |
| InChIKey | KONGTPTUDOIJJX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|