C10H15N3O5 — CID 54958554
4-[[1-(ethylamino)-1-oxopropan-2-yl]carbamoylamino]-4-oxobut-2-enoic acid (PubChem CID 54958554) has the molecular formula C10H15N3O5 and a molecular weight of 257.25 g/mol. Its IUPAC name is 4-[[1-(ethylamino)-1-oxopropan-2-yl]carbamoylamino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[[1-(ethylamino)-1-oxopropan-2-yl]carbamoylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 54958554 |
| Molecular Formula | C10H15N3O5 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 4-[[1-(ethylamino)-1-oxopropan-2-yl]carbamoylamino]-4-oxobut-2-enoic acid |
| SMILES | CCNC(=O)C(C)NC(=O)NC(=O)C=CC(=O)O |
| InChI | InChI=1S/C10H15N3O5/c1-3-11-9(17)6(2)12-10(18)13-7(14)4-5-8(15)16/h4-6H,3H2,1-2H3,(H,11,17)(H,15,16)(H2,12,13,14,18) |
| InChIKey | YEECSXSWZLWYPB-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|