C11H18N2O5 — CID 77055930
4-[(1-methoxy-3-methylbutan-2-yl)carbamoylamino]-4-oxobut-2-enoic acid (PubChem CID 77055930) has the molecular formula C11H18N2O5 and a molecular weight of 258.27 g/mol. Its IUPAC name is 4-[(1-methoxy-3-methylbutan-2-yl)carbamoylamino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[(1-methoxy-3-methylbutan-2-yl)carbamoylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 77055930 |
| Molecular Formula | C11H18N2O5 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 4-[(1-methoxy-3-methylbutan-2-yl)carbamoylamino]-4-oxobut-2-enoic acid |
| SMILES | COCC(NC(=O)NC(=O)C=CC(=O)O)C(C)C |
| InChI | InChI=1S/C11H18N2O5/c1-7(2)8(6-18-3)12-11(17)13-9(14)4-5-10(15)16/h4-5,7-8H,6H2,1-3H3,(H,15,16)(H2,12,13,14,17) |
| InChIKey | UTAXYKXRKMZCRO-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|