C11H16F3NOS — CID 54962068
1-thiophen-3-yl-N-[2-(2,2,2-trifluoroethoxy)ethyl]propan-2-amine (PubChem CID 54962068) has the molecular formula C11H16F3NOS and a molecular weight of 267.32 g/mol. Its IUPAC name is 1-thiophen-3-yl-N-[2-(2,2,2-trifluoroethoxy)ethyl]propan-2-amine.
| Compound Name | 1-thiophen-3-yl-N-[2-(2,2,2-trifluoroethoxy)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 54962068 |
| Molecular Formula | C11H16F3NOS |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 1-thiophen-3-yl-N-[2-(2,2,2-trifluoroethoxy)ethyl]propan-2-amine |
| SMILES | CC(Cc1ccsc1)NCCOCC(F)(F)F |
| InChI | InChI=1S/C11H16F3NOS/c1-9(6-10-2-5-17-7-10)15-3-4-16-8-11(12,13)14/h2,5,7,9,15H,3-4,6,8H2,1H3 |
| InChIKey | WSGQOXKBFNGKMI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|