C12H24N2O3S — CID 54962256
2-[(1,1-dioxothian-4-yl)amino]-N-(3-methylbutan-2-yl)acetamide (PubChem CID 54962256) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is 2-[(1,1-dioxothian-4-yl)amino]-N-(3-methylbutan-2-yl)acetamide.
| Compound Name | 2-[(1,1-dioxothian-4-yl)amino]-N-(3-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 54962256 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 2-[(1,1-dioxothian-4-yl)amino]-N-(3-methylbutan-2-yl)acetamide |
| SMILES | CC(C)C(C)NC(=O)CNC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H24N2O3S/c1-9(2)10(3)14-12(15)8-13-11-4-6-18(16,17)7-5-11/h9-11,13H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | SSUZUBHLOZVBDF-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |