C11H16ClN3O2S — CID 54963072
2-chloro-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylcarbamoyl]propanamide (PubChem CID 54963072) has the molecular formula C11H16ClN3O2S and a molecular weight of 289.79 g/mol. Its IUPAC name is 2-chloro-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylcarbamoyl]propanamide.
| Compound Name | 2-chloro-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylcarbamoyl]propanamide |
|---|---|
| PubChem CID | 54963072 |
| Molecular Formula | C11H16ClN3O2S |
| Molecular Weight | 289.79 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-chloro-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylcarbamoyl]propanamide |
| SMILES | Cc1nc(C)c(C(C)NC(=O)NC(=O)C(C)Cl)s1 |
| InChI | InChI=1S/C11H16ClN3O2S/c1-5(12)10(16)15-11(17)14-7(3)9-6(2)13-8(4)18-9/h5,7H,1-4H3,(H2,14,15,16,17) |
| InChIKey | BSYWPMWNLOVVFR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.79 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|