C14H16N2O3S — CID 104938902
N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-3,5-dihydroxybenzamide (PubChem CID 104938902) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-3,5-dihydroxybenzamide.
| Compound Name | N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 104938902 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-3,5-dihydroxybenzamide |
| SMILES | Cc1nc(C)c(C(C)NC(=O)c2cc(O)cc(O)c2)s1 |
| InChI | InChI=1S/C14H16N2O3S/c1-7-13(20-9(3)15-7)8(2)16-14(19)10-4-11(17)6-12(18)5-10/h4-6,8,17-18H,1-3H3,(H,16,19) |
| InChIKey | UTVBCTUYLJQYNX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |