C15H19N3OS — CID 61193208
3-amino-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-methylbenzamide (PubChem CID 61193208) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 3-amino-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-methylbenzamide.
| Compound Name | 3-amino-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 61193208 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 3-amino-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-methylbenzamide |
| SMILES | Cc1nc(C)c(C(C)NC(=O)c2ccc(C)c(N)c2)s1 |
| InChI | InChI=1S/C15H19N3OS/c1-8-5-6-12(7-13(8)16)15(19)18-10(3)14-9(2)17-11(4)20-14/h5-7,10H,16H2,1-4H3,(H,18,19) |
| InChIKey | DSMUSSZTRGDZNC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|