C14H15F2N3OS — CID 61192271
5-amino-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2,4-difluorobenzamide (PubChem CID 61192271) has the molecular formula C14H15F2N3OS and a molecular weight of 311.36 g/mol. Its IUPAC name is 5-amino-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2,4-difluorobenzamide.
| Compound Name | 5-amino-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 61192271 |
| Molecular Formula | C14H15F2N3OS |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 5-amino-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2,4-difluorobenzamide |
| SMILES | Cc1nc(C)c(C(C)NC(=O)c2cc(N)c(F)cc2F)s1 |
| InChI | InChI=1S/C14H15F2N3OS/c1-6-13(21-8(3)18-6)7(2)19-14(20)9-4-12(17)11(16)5-10(9)15/h4-5,7H,17H2,1-3H3,(H,19,20) |
| InChIKey | VGSJUGLTJOABAY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|