C14H15FN2OS — CID 47317355
N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-fluorobenzamide (PubChem CID 47317355) has the molecular formula C14H15FN2OS and a molecular weight of 278.35 g/mol. Its IUPAC name is N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-fluorobenzamide.
| Compound Name | N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 47317355 |
| Molecular Formula | C14H15FN2OS |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-fluorobenzamide |
| SMILES | Cc1nc(C)c(C(C)NC(=O)c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C14H15FN2OS/c1-8-13(19-10(3)16-8)9(2)17-14(18)11-4-6-12(15)7-5-11/h4-7,9H,1-3H3,(H,17,18) |
| InChIKey | XKMFBDQVCXUKBK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |