C14H16ClN3OS — CID 61192619
3-amino-4-chloro-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]benzamide (PubChem CID 61192619) has the molecular formula C14H16ClN3OS and a molecular weight of 309.82 g/mol. Its IUPAC name is 3-amino-4-chloro-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]benzamide.
| Compound Name | 3-amino-4-chloro-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 61192619 |
| Molecular Formula | C14H16ClN3OS |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 3-amino-4-chloro-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]benzamide |
| SMILES | Cc1nc(C)c(C(C)NC(=O)c2ccc(Cl)c(N)c2)s1 |
| InChI | InChI=1S/C14H16ClN3OS/c1-7-13(20-9(3)17-7)8(2)18-14(19)10-4-5-11(15)12(16)6-10/h4-6,8H,16H2,1-3H3,(H,18,19) |
| InChIKey | ZSPNWWRJKXEUPN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|