C15H17ClN2OS — CID 61192187
4-(chloromethyl)-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]benzamide (PubChem CID 61192187) has the molecular formula C15H17ClN2OS and a molecular weight of 308.83 g/mol. Its IUPAC name is 4-(chloromethyl)-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]benzamide.
| Compound Name | 4-(chloromethyl)-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 61192187 |
| Molecular Formula | C15H17ClN2OS |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 4-(chloromethyl)-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]benzamide |
| SMILES | Cc1nc(C)c(C(C)NC(=O)c2ccc(CCl)cc2)s1 |
| InChI | InChI=1S/C15H17ClN2OS/c1-9-14(20-11(3)17-9)10(2)18-15(19)13-6-4-12(8-16)5-7-13/h4-7,10H,8H2,1-3H3,(H,18,19) |
| InChIKey | SYYDOMALRSTCEO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|