C12H14N2OS3 — CID 107025593
N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-sulfanylthiophene-2-carboxamide (PubChem CID 107025593) has the molecular formula C12H14N2OS3 and a molecular weight of 298.46 g/mol. Its IUPAC name is N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-sulfanylthiophene-2-carboxamide.
| Compound Name | N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107025593 |
| Molecular Formula | C12H14N2OS3 |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-4-sulfanylthiophene-2-carboxamide |
| SMILES | Cc1nc(C)c(C(C)NC(=O)c2cc(S)cs2)s1 |
| InChI | InChI=1S/C12H14N2OS3/c1-6-11(18-8(3)13-6)7(2)14-12(15)10-4-9(16)5-17-10/h4-5,7,16H,1-3H3,(H,14,15) |
| InChIKey | GGDBNPATLOLAFJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|