C14H15FN2OS2 — CID 107025589
N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-fluoro-5-sulfanylbenzamide (PubChem CID 107025589) has the molecular formula C14H15FN2OS2 and a molecular weight of 310.42 g/mol. Its IUPAC name is N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-fluoro-5-sulfanylbenzamide.
| Compound Name | N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-fluoro-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107025589 |
| Molecular Formula | C14H15FN2OS2 |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-2-fluoro-5-sulfanylbenzamide |
| SMILES | Cc1nc(C)c(C(C)NC(=O)c2cc(S)ccc2F)s1 |
| InChI | InChI=1S/C14H15FN2OS2/c1-7-13(20-9(3)16-7)8(2)17-14(18)11-6-10(19)4-5-12(11)15/h4-6,8,19H,1-3H3,(H,17,18) |
| InChIKey | QDVJEWNTFHAJAM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|