C13H15ClN2OS — CID 54966901
1-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]pyridin-2-one (PubChem CID 54966901) has the molecular formula C13H15ClN2OS and a molecular weight of 282.80 g/mol. Its IUPAC name is 1-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]pyridin-2-one.
| Compound Name | 1-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]pyridin-2-one |
|---|---|
| PubChem CID | 54966901 |
| Molecular Formula | C13H15ClN2OS |
| Molecular Weight | 282.80 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 1-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]pyridin-2-one |
| SMILES | O=c1ccccn1CCCCc1nc(CCl)cs1 |
| InChI | InChI=1S/C13H15ClN2OS/c14-9-11-10-18-12(15-11)5-1-3-7-16-8-4-2-6-13(16)17/h2,4,6,8,10H,1,3,5,7,9H2 |
| InChIKey | OSRCBGWKKWJFHK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.80 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|