C27H46 — CID 5496711
(6E,10Z,14E,18E)-2,10,23-trimethyltetracosa-2,6,10,14,18-pentaene (PubChem CID 5496711) has the molecular formula C27H46 and a molecular weight of 370.67 g/mol. Its IUPAC name is (6E,10Z,14E,18E)-2,10,23-trimethyltetracosa-2,6,10,14,18-pentaene.
| Compound Name | (6E,10Z,14E,18E)-2,10,23-trimethyltetracosa-2,6,10,14,18-pentaene |
|---|---|
| PubChem CID | 5496711 |
| Molecular Formula | C27H46 |
| Molecular Weight | 370.67 g/mol |
| Exact Mass | 370.36 |
| IUPAC Name | (6E,10Z,14E,18E)-2,10,23-trimethyltetracosa-2,6,10,14,18-pentaene |
| SMILES | CC(C)=CCC/C=C/CC/C(C)=C\CC/C=C/CC/C=C/CCCC(C)C |
| InChI | InChI=1S/C27H46/c1-25(2)21-17-13-10-8-6-7-9-11-15-19-23-27(5)24-20-16-12-14-18-22-26(3)4/h8-12,16,22-23,25H,6-7,13-15,17-21,24H2,1-5H3/b10-8+,11-9+,16-12+,27-23- |
| InChIKey | RPCZHDAKJAJKQV-RABMJZNOSA-N |
| XLogP | 9.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.67 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|