C12H13FN2O2 — CID 54967183
[2-fluoro-5-(4-hydroxybut-1-ynyl)phenyl]methylurea (PubChem CID 54967183) has the molecular formula C12H13FN2O2 and a molecular weight of 236.25 g/mol. Its IUPAC name is [2-fluoro-5-(4-hydroxybut-1-ynyl)phenyl]methylurea.
| Compound Name | [2-fluoro-5-(4-hydroxybut-1-ynyl)phenyl]methylurea |
|---|---|
| PubChem CID | 54967183 |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | [2-fluoro-5-(4-hydroxybut-1-ynyl)phenyl]methylurea |
| SMILES | NC(=O)NCc1cc(C#CCCO)ccc1F |
| InChI | InChI=1S/C12H13FN2O2/c13-11-5-4-9(3-1-2-6-16)7-10(11)8-15-12(14)17/h4-5,7,16H,2,6,8H2,(H3,14,15,17) |
| InChIKey | HVILAFKTIXKZDK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|