C10H12BN3O2S — CID 54969387
[2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]phenyl]boronic acid (PubChem CID 54969387) has the molecular formula C10H12BN3O2S and a molecular weight of 249.10 g/mol. Its IUPAC name is [2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]phenyl]boronic acid.
| Compound Name | [2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 54969387 |
| Molecular Formula | C10H12BN3O2S |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | [2-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanylmethyl]phenyl]boronic acid |
| SMILES | Cc1nc(SCc2ccccc2B(O)O)n[nH]1 |
| InChI | InChI=1S/C10H12BN3O2S/c1-7-12-10(14-13-7)17-6-8-4-2-3-5-9(8)11(15)16/h2-5,15-16H,6H2,1H3,(H,12,13,14) |
| InChIKey | DIIJBHLDUCNINM-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|