C13H12ClN3 — CID 54970106
3-[3-[(4-chloropyrazol-1-yl)methyl]phenyl]prop-2-yn-1-amine (PubChem CID 54970106) has the molecular formula C13H12ClN3 and a molecular weight of 245.71 g/mol. Its IUPAC name is 3-[3-[(4-chloropyrazol-1-yl)methyl]phenyl]prop-2-yn-1-amine.
| Compound Name | 3-[3-[(4-chloropyrazol-1-yl)methyl]phenyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 54970106 |
| Molecular Formula | C13H12ClN3 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 3-[3-[(4-chloropyrazol-1-yl)methyl]phenyl]prop-2-yn-1-amine |
| SMILES | NCC#Cc1cccc(Cn2cc(Cl)cn2)c1 |
| InChI | InChI=1S/C13H12ClN3/c14-13-8-16-17(10-13)9-12-4-1-3-11(7-12)5-2-6-15/h1,3-4,7-8,10H,6,9,15H2 |
| InChIKey | MGIDWBVHTYLNRQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|