C13H22BNO2 — CID 54970429
[4-[[methyl(2-methylbutyl)amino]methyl]phenyl]boronic acid (PubChem CID 54970429) has the molecular formula C13H22BNO2 and a molecular weight of 235.14 g/mol. Its IUPAC name is [4-[[methyl(2-methylbutyl)amino]methyl]phenyl]boronic acid.
| Compound Name | [4-[[methyl(2-methylbutyl)amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 54970429 |
| Molecular Formula | C13H22BNO2 |
| Molecular Weight | 235.14 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | [4-[[methyl(2-methylbutyl)amino]methyl]phenyl]boronic acid |
| SMILES | CCC(C)CN(C)Cc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C13H22BNO2/c1-4-11(2)9-15(3)10-12-5-7-13(8-6-12)14(16)17/h5-8,11,16-17H,4,9-10H2,1-3H3 |
| InChIKey | FUWLGDVHPVWBIV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.14 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|