C12H22N2O3S — CID 54972457
N-[2-(furan-2-yl)ethyl]-3-(propan-2-ylamino)propane-1-sulfonamide (PubChem CID 54972457) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-3-(propan-2-ylamino)propane-1-sulfonamide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-3-(propan-2-ylamino)propane-1-sulfonamide |
|---|---|
| PubChem CID | 54972457 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-3-(propan-2-ylamino)propane-1-sulfonamide |
| SMILES | CC(C)NCCCS(=O)(=O)NCCc1ccco1 |
| InChI | InChI=1S/C12H22N2O3S/c1-11(2)13-7-4-10-18(15,16)14-8-6-12-5-3-9-17-12/h3,5,9,11,13-14H,4,6-8,10H2,1-2H3 |
| InChIKey | WQOAILZOYFPACP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|