C15H19NO2 — CID 54974929
3-[3-[[cyclopropyl(ethyl)amino]methyl]phenyl]prop-2-enoic acid (PubChem CID 54974929) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 3-[3-[[cyclopropyl(ethyl)amino]methyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[[cyclopropyl(ethyl)amino]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54974929 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 3-[3-[[cyclopropyl(ethyl)amino]methyl]phenyl]prop-2-enoic acid |
| SMILES | CCN(Cc1cccc(C=CC(=O)O)c1)C1CC1 |
| InChI | InChI=1S/C15H19NO2/c1-2-16(14-7-8-14)11-13-5-3-4-12(10-13)6-9-15(17)18/h3-6,9-10,14H,2,7-8,11H2,1H3,(H,17,18) |
| InChIKey | RNVVRRLLNQCGSN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|