C16H21NO2 — CID 76996477
3-[3-[[cyclopropylmethyl(ethyl)amino]methyl]phenyl]prop-2-enoic acid (PubChem CID 76996477) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-[3-[[cyclopropylmethyl(ethyl)amino]methyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[[cyclopropylmethyl(ethyl)amino]methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76996477 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 3-[3-[[cyclopropylmethyl(ethyl)amino]methyl]phenyl]prop-2-enoic acid |
| SMILES | CCN(Cc1cccc(C=CC(=O)O)c1)CC1CC1 |
| InChI | InChI=1S/C16H21NO2/c1-2-17(11-14-6-7-14)12-15-5-3-4-13(10-15)8-9-16(18)19/h3-5,8-10,14H,2,6-7,11-12H2,1H3,(H,18,19) |
| InChIKey | WIWZGOAJTCVOCP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|