C27H40N2O2 — CID 142934541
[4-[[bis[(3-methylphenyl)methyl]amino]methyl]cyclohexyl]methanamine;propanoic acid (PubChem CID 142934541) has the molecular formula C27H40N2O2 and a molecular weight of 424.63 g/mol. Its IUPAC name is [4-[[bis[(3-methylphenyl)methyl]amino]methyl]cyclohexyl]methanamine;propanoic acid.
| Compound Name | [4-[[bis[(3-methylphenyl)methyl]amino]methyl]cyclohexyl]methanamine;propanoic acid |
|---|---|
| PubChem CID | 142934541 |
| Molecular Formula | C27H40N2O2 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.31 |
| IUPAC Name | [4-[[bis[(3-methylphenyl)methyl]amino]methyl]cyclohexyl]methanamine;propanoic acid |
| SMILES | CCC(=O)O.Cc1cccc(CN(Cc2cccc(C)c2)CC2CCC(CN)CC2)c1 |
| InChI | InChI=1S/C24H34N2.C3H6O2/c1-19-5-3-7-23(13-19)17-26(18-24-8-4-6-20(2)14-24)16-22-11-9-21(15-25)10-12-22;1-2-3(4)5/h3-8,13-14,21-22H,9-12,15-18,25H2,1-2H3;2H2,1H3,(H,4,5) |
| InChIKey | JKYMWNHLQPDLBZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |