C22H28BrN3O2 — CID 23739965
[4-[[(3-bromophenyl)methyl-[(4-nitrophenyl)methyl]amino]methyl]cyclohexyl]methanamine (PubChem CID 23739965) has the molecular formula C22H28BrN3O2 and a molecular weight of 446.39 g/mol. Its IUPAC name is [4-[[(3-bromophenyl)methyl-[(4-nitrophenyl)methyl]amino]methyl]cyclohexyl]methanamine.
| Compound Name | [4-[[(3-bromophenyl)methyl-[(4-nitrophenyl)methyl]amino]methyl]cyclohexyl]methanamine |
|---|---|
| PubChem CID | 23739965 |
| Molecular Formula | C22H28BrN3O2 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | [4-[[(3-bromophenyl)methyl-[(4-nitrophenyl)methyl]amino]methyl]cyclohexyl]methanamine |
| SMILES | NCC1CCC(CN(Cc2ccc([N+](=O)[O-])cc2)Cc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C22H28BrN3O2/c23-21-3-1-2-20(12-21)16-25(14-18-6-4-17(13-24)5-7-18)15-19-8-10-22(11-9-19)26(27)28/h1-3,8-12,17-18H,4-7,13-16,24H2 |
| InChIKey | ADERQUMYVHDUTD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|