C14H24N2O — CID 54975952
1-[1-(furan-2-yl)propan-2-yl]-N,3-dimethylpiperidin-4-amine (PubChem CID 54975952) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-[1-(furan-2-yl)propan-2-yl]-N,3-dimethylpiperidin-4-amine.
| Compound Name | 1-[1-(furan-2-yl)propan-2-yl]-N,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 54975952 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 1-[1-(furan-2-yl)propan-2-yl]-N,3-dimethylpiperidin-4-amine |
| SMILES | CNC1CCN(C(C)Cc2ccco2)CC1C |
| InChI | InChI=1S/C14H24N2O/c1-11-10-16(7-6-14(11)15-3)12(2)9-13-5-4-8-17-13/h4-5,8,11-12,14-15H,6-7,9-10H2,1-3H3 |
| InChIKey | MNNBFANDNBSJAW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |