C18H17ClN4OS — CID 5497795
1-[(Z)-[1-[(2-chlorophenyl)methyl]-2-oxoindol-3-ylidene]amino]-1,3-dimethylthiourea (PubChem CID 5497795) has the molecular formula C18H17ClN4OS and a molecular weight of 372.88 g/mol. Its IUPAC name is 1-[(Z)-[1-[(2-chlorophenyl)methyl]-2-oxoindol-3-ylidene]amino]-1,3-dimethylthiourea.
| Compound Name | 1-[(Z)-[1-[(2-chlorophenyl)methyl]-2-oxoindol-3-ylidene]amino]-1,3-dimethylthiourea |
|---|---|
| PubChem CID | 5497795 |
| Molecular Formula | C18H17ClN4OS |
| Molecular Weight | 372.88 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 1-[(Z)-[1-[(2-chlorophenyl)methyl]-2-oxoindol-3-ylidene]amino]-1,3-dimethylthiourea |
| SMILES | CNC(=S)N(C)/N=C1\C(=O)N(Cc2ccccc2Cl)c2ccccc21 |
| InChI | InChI=1S/C18H17ClN4OS/c1-20-18(25)22(2)21-16-13-8-4-6-10-15(13)23(17(16)24)11-12-7-3-5-9-14(12)19/h3-10H,11H2,1-2H3,(H,20,25)/b21-16- |
| InChIKey | LXPARMCJJHKUHI-PGMHBOJBSA-N |
| XLogP | 3.03 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.88 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|