C12H13BrN2O2S — CID 54982820
4-(4-bromoanilino)-1,1-dioxothiane-4-carbonitrile (PubChem CID 54982820) has the molecular formula C12H13BrN2O2S and a molecular weight of 329.22 g/mol. Its IUPAC name is 4-(4-bromoanilino)-1,1-dioxothiane-4-carbonitrile.
| Compound Name | 4-(4-bromoanilino)-1,1-dioxothiane-4-carbonitrile |
|---|---|
| PubChem CID | 54982820 |
| Molecular Formula | C12H13BrN2O2S |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 4-(4-bromoanilino)-1,1-dioxothiane-4-carbonitrile |
| SMILES | N#CC1(Nc2ccc(Br)cc2)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H13BrN2O2S/c13-10-1-3-11(4-2-10)15-12(9-14)5-7-18(16,17)8-6-12/h1-4,15H,5-8H2 |
| InChIKey | NQQFEERUSJXOKW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |