C12H13ClN2O2S — CID 63922863
3-(4-chloroanilino)-1,1-dioxothiane-3-carbonitrile (PubChem CID 63922863) has the molecular formula C12H13ClN2O2S and a molecular weight of 284.77 g/mol. Its IUPAC name is 3-(4-chloroanilino)-1,1-dioxothiane-3-carbonitrile.
| Compound Name | 3-(4-chloroanilino)-1,1-dioxothiane-3-carbonitrile |
|---|---|
| PubChem CID | 63922863 |
| Molecular Formula | C12H13ClN2O2S |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 3-(4-chloroanilino)-1,1-dioxothiane-3-carbonitrile |
| SMILES | N#CC1(Nc2ccc(Cl)cc2)CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H13ClN2O2S/c13-10-2-4-11(5-3-10)15-12(8-14)6-1-7-18(16,17)9-12/h2-5,15H,1,6-7,9H2 |
| InChIKey | BHOWKSQZMOTIGW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |