C13H16N2O3S — CID 63923259
3-(3-methoxyanilino)-1,1-dioxothiane-3-carbonitrile (PubChem CID 63923259) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 3-(3-methoxyanilino)-1,1-dioxothiane-3-carbonitrile.
| Compound Name | 3-(3-methoxyanilino)-1,1-dioxothiane-3-carbonitrile |
|---|---|
| PubChem CID | 63923259 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3-(3-methoxyanilino)-1,1-dioxothiane-3-carbonitrile |
| SMILES | COc1cccc(NC2(C#N)CCCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H16N2O3S/c1-18-12-5-2-4-11(8-12)15-13(9-14)6-3-7-19(16,17)10-13/h2,4-5,8,15H,3,6-7,10H2,1H3 |
| InChIKey | UAIXOYHGQFSMMJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |