C13H17NO5S — CID 63910469
3-(3-methoxyanilino)-1,1-dioxothiane-3-carboxylic acid (PubChem CID 63910469) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is 3-(3-methoxyanilino)-1,1-dioxothiane-3-carboxylic acid.
| Compound Name | 3-(3-methoxyanilino)-1,1-dioxothiane-3-carboxylic acid |
|---|---|
| PubChem CID | 63910469 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 3-(3-methoxyanilino)-1,1-dioxothiane-3-carboxylic acid |
| SMILES | COc1cccc(NC2(C(=O)O)CCCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H17NO5S/c1-19-11-5-2-4-10(8-11)14-13(12(15)16)6-3-7-20(17,18)9-13/h2,4-5,8,14H,3,6-7,9H2,1H3,(H,15,16) |
| InChIKey | JFVWPGSCCGVNEF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |