C9H18F3N3O2 — CID 54989201
2-[(3-amino-1,1,1-trifluoropropan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 54989201) has the molecular formula C9H18F3N3O2 and a molecular weight of 257.26 g/mol. Its IUPAC name is 2-[(3-amino-1,1,1-trifluoropropan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(3-amino-1,1,1-trifluoropropan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 54989201 |
| Molecular Formula | C9H18F3N3O2 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2-[(3-amino-1,1,1-trifluoropropan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(C)C(CN)C(F)(F)F |
| InChI | InChI=1S/C9H18F3N3O2/c1-15(7(5-13)9(10,11)12)6-8(16)14-3-4-17-2/h7H,3-6,13H2,1-2H3,(H,14,16) |
| InChIKey | OUUPQTXQWQEWMO-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|