About 2-[(3-amino-1,1,1-trifluoropropan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide
2-[(3-amino-1,1,1-trifluoropropan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide (PubChem CID 54989201) has the molecular formula C9H18F3N3O2
and a molecular weight of 257.26 g/mol. Its IUPAC name is 2-[(3-amino-1,1,1-trifluoropropan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide.
Molecular Properties
| Compound Name | 2-[(3-amino-1,1,1-trifluoropropan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide |
| PubChem CID | 54989201 |
| Molecular Formula | C9H18F3N3O2 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2-[(3-amino-1,1,1-trifluoropropan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN(C)C(CN)C(F)(F)F |
| InChI | InChI=1S/C9H18F3N3O2/c1-15(7(5-13)9(10,11)12)6-8(16)14-3-4-17-2/h7H,3-6,13H2,1-2H3,(H,14,16) |
| InChIKey | OUUPQTXQWQEWMO-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-amino-1,1,1-trifluoropropan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-amino-1,1,1-trifluoropropan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide?
The IUPAC name of 2-[(3-amino-1,1,1-trifluoropropan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide (CID 54989201) is 2-[(3-amino-1,1,1-trifluoropropan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide.
What is the SMILES notation for 2-[(3-amino-1,1,1-trifluoropropan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide?
The canonical SMILES for 2-[(3-amino-1,1,1-trifluoropropan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide is COCCNC(=O)CN(C)C(CN)C(F)(F)F.
What is the InChIKey of 2-[(3-amino-1,1,1-trifluoropropan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide?
The InChIKey is OUUPQTXQWQEWMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F3N3O2/c1-15(7(5-13)9(10,11)12)6-8(16)14-3-4-17-2/h7H,3-6,13H2,1-2H3,(H,14,16).
What are the key properties of 2-[(3-amino-1,1,1-trifluoropropan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide?
2-[(3-amino-1,1,1-trifluoropropan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide has a molecular weight of 257.26 g/mol, XLogP of -0.43, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-amino-1,1,1-trifluoropropan-2-yl)-methylamino]-N-(2-methoxyethyl)acetamide is sourced from PubChem (CID 54989201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).