C14H22N2O2S — CID 54991879
3-[(3,4-dimethoxyphenyl)methyl-methylamino]-2-methylpropanethioamide (PubChem CID 54991879) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methyl-methylamino]-2-methylpropanethioamide.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methyl-methylamino]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 54991879 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methyl-methylamino]-2-methylpropanethioamide |
| SMILES | COc1ccc(CN(C)CC(C)C(N)=S)cc1OC |
| InChI | InChI=1S/C14H22N2O2S/c1-10(14(15)19)8-16(2)9-11-5-6-12(17-3)13(7-11)18-4/h5-7,10H,8-9H2,1-4H3,(H2,15,19) |
| InChIKey | ZKKOGSPBKQFKSE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|