C13H20BrNO2 — CID 80667582
2-bromo-N-[(3,4-dimethoxyphenyl)methyl]-N-methylpropan-1-amine (PubChem CID 80667582) has the molecular formula C13H20BrNO2 and a molecular weight of 302.21 g/mol. Its IUPAC name is 2-bromo-N-[(3,4-dimethoxyphenyl)methyl]-N-methylpropan-1-amine.
| Compound Name | 2-bromo-N-[(3,4-dimethoxyphenyl)methyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 80667582 |
| Molecular Formula | C13H20BrNO2 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-bromo-N-[(3,4-dimethoxyphenyl)methyl]-N-methylpropan-1-amine |
| SMILES | COc1ccc(CN(C)CC(C)Br)cc1OC |
| InChI | InChI=1S/C13H20BrNO2/c1-10(14)8-15(2)9-11-5-6-12(16-3)13(7-11)17-4/h5-7,10H,8-9H2,1-4H3 |
| InChIKey | PZWXLMUXKHJIBO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|