C14H22N2O2 — CID 55003773
1-(cyclopropylamino)-3-[cyclopropyl(furan-2-ylmethyl)amino]propan-2-ol (PubChem CID 55003773) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-(cyclopropylamino)-3-[cyclopropyl(furan-2-ylmethyl)amino]propan-2-ol.
| Compound Name | 1-(cyclopropylamino)-3-[cyclopropyl(furan-2-ylmethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 55003773 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-(cyclopropylamino)-3-[cyclopropyl(furan-2-ylmethyl)amino]propan-2-ol |
| SMILES | OC(CNC1CC1)CN(Cc1ccco1)C1CC1 |
| InChI | InChI=1S/C14H22N2O2/c17-13(8-15-11-3-4-11)9-16(12-5-6-12)10-14-2-1-7-18-14/h1-2,7,11-13,15,17H,3-6,8-10H2 |
| InChIKey | KLBGEPXFJXWXIJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 48.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |