C10H20O4P2S2 — CID 550049
2-(5,5-dimethyl-2-sulfanylidene-1,3,2lambda5-dioxaphosphinan-2-yl)-5,5-dimethyl-2-sulfanylidene-1,3,2lambda5-dioxaphosphinane (PubChem CID 550049) has the molecular formula C10H20O4P2S2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 2-(5,5-dimethyl-2-sulfanylidene-1,3,2lambda5-dioxaphosphinan-2-yl)-5,5-dimethyl-2-sulfanylidene-1,3,2lambda5-dioxaphosphinane.
| Compound Name | 2-(5,5-dimethyl-2-sulfanylidene-1,3,2lambda5-dioxaphosphinan-2-yl)-5,5-dimethyl-2-sulfanylidene-1,3,2lambda5-dioxaphosphinane |
|---|---|
| PubChem CID | 550049 |
| Molecular Formula | C10H20O4P2S2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2-(5,5-dimethyl-2-sulfanylidene-1,3,2lambda5-dioxaphosphinan-2-yl)-5,5-dimethyl-2-sulfanylidene-1,3,2lambda5-dioxaphosphinane |
| SMILES | CC1(C)COP(=S)(P2(=S)OCC(C)(C)CO2)OC1 |
| InChI | InChI=1S/C10H20O4P2S2/c1-9(2)5-11-15(17,12-6-9)16(18)13-7-10(3,4)8-14-16/h5-8H2,1-4H3 |
| InChIKey | QSWJZEAZEDTWLF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|