C14H21F3N2 — CID 55010763
4-[1-(methylamino)ethyl]-N-propan-2-yl-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 55010763) has the molecular formula C14H21F3N2 and a molecular weight of 274.33 g/mol. Its IUPAC name is 4-[1-(methylamino)ethyl]-N-propan-2-yl-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 4-[1-(methylamino)ethyl]-N-propan-2-yl-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 55010763 |
| Molecular Formula | C14H21F3N2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 4-[1-(methylamino)ethyl]-N-propan-2-yl-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | CNC(C)c1ccc(N(CC(F)(F)F)C(C)C)cc1 |
| InChI | InChI=1S/C14H21F3N2/c1-10(2)19(9-14(15,16)17)13-7-5-12(6-8-13)11(3)18-4/h5-8,10-11,18H,9H2,1-4H3 |
| InChIKey | JGJZEYBDNFHYNK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|