C13H20N2O4 — CID 55011790
(E)-4-[(2-methylcyclohexyl)methylcarbamoylamino]-4-oxobut-2-enoic acid (PubChem CID 55011790) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is (E)-4-[(2-methylcyclohexyl)methylcarbamoylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[(2-methylcyclohexyl)methylcarbamoylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 55011790 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (E)-4-[(2-methylcyclohexyl)methylcarbamoylamino]-4-oxobut-2-enoic acid |
| SMILES | CC1CCCCC1CNC(=O)NC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C13H20N2O4/c1-9-4-2-3-5-10(9)8-14-13(19)15-11(16)6-7-12(17)18/h6-7,9-10H,2-5,8H2,1H3,(H,17,18)(H2,14,15,16,19)/b7-6+ |
| InChIKey | MIEXQGWCBFCJRJ-VOTSOKGWSA-N |
| XLogP | 1.28 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|