C10H15NO4 — CID 77125132
4-[(2-hydroxycyclopentyl)methylamino]-4-oxobut-2-enoic acid (PubChem CID 77125132) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 4-[(2-hydroxycyclopentyl)methylamino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[(2-hydroxycyclopentyl)methylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 77125132 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 4-[(2-hydroxycyclopentyl)methylamino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)NCC1CCCC1O |
| InChI | InChI=1S/C10H15NO4/c12-8-3-1-2-7(8)6-11-9(13)4-5-10(14)15/h4-5,7-8,12H,1-3,6H2,(H,11,13)(H,14,15) |
| InChIKey | OXHSPSSAPWDFJB-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|